C21H24N4O4 — CID 140562853
N-(4-carbamimidoylphenyl)-2-[(2R)-4-(4-ethylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide (PubChem CID 140562853) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2-[(2R)-4-(4-ethylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-(4-ethylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 140562853 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-(4-ethylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(O)[C@H]2OCCN(c3ccc(CC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-2-13-3-9-16(10-4-13)25-11-12-29-18(21(25)28)17(26)20(27)24-15-7-5-14(6-8-15)19(22)23/h3-10,17-18,26H,2,11-12H2,1H3,(H3,22,23)(H,24,27)/t17?,18-/m1/s1 |
| InChIKey | KVBZWPOZOSNPSJ-QRWMCTBCSA-N |
| XLogP | 1.26 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|