C25H30N4O4 — CID 46221305
(2R)-N-(4-carbamimidoylphenyl)-2-[4-(4-cyclohexylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide (PubChem CID 46221305) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (2R)-N-(4-carbamimidoylphenyl)-2-[4-(4-cyclohexylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide.
| Compound Name | (2R)-N-(4-carbamimidoylphenyl)-2-[4-(4-cyclohexylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 46221305 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (2R)-N-(4-carbamimidoylphenyl)-2-[4-(4-cyclohexylphenyl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)[C@H](O)C2OCCN(c3ccc(C4CCCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H30N4O4/c26-23(27)18-6-10-19(11-7-18)28-24(31)21(30)22-25(32)29(14-15-33-22)20-12-8-17(9-13-20)16-4-2-1-3-5-16/h6-13,16,21-22,30H,1-5,14-15H2,(H3,26,27)(H,28,31)/t21-,22?/m1/s1 |
| InChIKey | YCECMTRGWOKLMF-ZMFCMNQTSA-N |
| XLogP | 2.75 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|