C22H24N4O6S — CID 67222689
(2R)-N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-6-yl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide (PubChem CID 67222689) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is (2R)-N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-6-yl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide.
| Compound Name | (2R)-N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-6-yl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 67222689 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (2R)-N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-isothiochromen-6-yl)-3-oxomorpholin-2-yl]-2-hydroxyacetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)[C@H](O)[C@H]2OCCN(c3ccc4c(c3)CCS(=O)(=O)C4)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O6S/c23-20(24)13-1-4-16(5-2-13)25-21(28)18(27)19-22(29)26(8-9-32-19)17-6-3-15-12-33(30,31)10-7-14(15)11-17/h1-6,11,18-19,27H,7-10,12H2,(H3,23,24)(H,25,28)/t18-,19-/m1/s1 |
| InChIKey | BQKPPLIHKIWPLA-RTBURBONSA-N |
| XLogP | 0.17 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|