C21H23N5O5 — CID 70224828
N-(4-carbamimidoylphenyl)-2-[(2R)-4-[4-[(2-hydroxyacetyl)amino]phenyl]-3-oxomorpholin-2-yl]acetamide (PubChem CID 70224828) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2-[(2R)-4-[4-[(2-hydroxyacetyl)amino]phenyl]-3-oxomorpholin-2-yl]acetamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-[4-[(2-hydroxyacetyl)amino]phenyl]-3-oxomorpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 70224828 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-[4-[(2-hydroxyacetyl)amino]phenyl]-3-oxomorpholin-2-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C[C@H]2OCCN(c3ccc(NC(=O)CO)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N5O5/c22-20(23)13-1-3-14(4-2-13)24-18(28)11-17-21(30)26(9-10-31-17)16-7-5-15(6-8-16)25-19(29)12-27/h1-8,17,27H,9-12H2,(H3,22,23)(H,24,28)(H,25,29)/t17-/m1/s1 |
| InChIKey | UKPZVWIRVZYVNC-QGZVFWFLSA-N |
| XLogP | 0.66 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|