C13H14N2O5 — CID 11097854
2-[(2R)-4-benzamido-3-oxomorpholin-2-yl]acetic acid (PubChem CID 11097854) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[(2R)-4-benzamido-3-oxomorpholin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-4-benzamido-3-oxomorpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 11097854 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[(2R)-4-benzamido-3-oxomorpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1OCCN(NC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C13H14N2O5/c16-11(17)8-10-13(19)15(6-7-20-10)14-12(18)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,18)(H,16,17)/t10-/m1/s1 |
| InChIKey | SBMCPJKHFADWHZ-SNVBAGLBSA-N |
| XLogP | 0.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |