C24H31N5O5 — CID 10895977
[amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate (PubChem CID 10895977) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is [amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate.
| Compound Name | [amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate |
|---|---|
| PubChem CID | 10895977 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate |
| SMILES | CC(=O)[O-].NC(=[NH2+])c1ccc(CNC(=O)C[C@@H]2OCCN(NCCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H27N5O3.C2H4O2/c23-21(24)18-8-6-17(7-9-18)15-25-20(28)14-19-22(29)27(12-13-30-19)26-11-10-16-4-2-1-3-5-16;1-2(3)4/h1-9,19,26H,10-15H2,(H3,23,24)(H,25,28);1H3,(H,3,4)/t19-;/m0./s1 |
| InChIKey | GNUQEWZOVBXDJJ-FYZYNONXSA-N |
| XLogP | -2.11 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|