C22H26N6O7 — CID 11134672
[amino-[4-[[[2-[4-(3-nitroanilino)-3-oxomorpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate (PubChem CID 11134672) has the molecular formula C22H26N6O7 and a molecular weight of 486.49 g/mol. Its IUPAC name is [amino-[4-[[[2-[4-(3-nitroanilino)-3-oxomorpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate.
| Compound Name | [amino-[4-[[[2-[4-(3-nitroanilino)-3-oxomorpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate |
|---|---|
| PubChem CID | 11134672 |
| Molecular Formula | C22H26N6O7 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [amino-[4-[[[2-[4-(3-nitroanilino)-3-oxomorpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]azanium acetate |
| SMILES | CC(=O)[O-].NC(=[NH2+])c1ccc(CNC(=O)CC2OCCN(Nc3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N6O5.C2H4O2/c21-19(22)14-6-4-13(5-7-14)12-23-18(27)11-17-20(28)25(8-9-31-17)24-15-2-1-3-16(10-15)26(29)30;1-2(3)4/h1-7,10,17,24H,8-9,11-12H2,(H3,21,22)(H,23,27);1H3,(H,3,4) |
| InChIKey | IBGMHWZBKBQKMT-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 205.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|