C17H18N4O4 — CID 71894770
N-[[4-(dimethylamino)phenyl]methyl]-N'-(3-nitrophenyl)oxamide (PubChem CID 71894770) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N'-(3-nitrophenyl)oxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N'-(3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 71894770 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N'-(3-nitrophenyl)oxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H18N4O4/c1-20(2)14-8-6-12(7-9-14)11-18-16(22)17(23)19-13-4-3-5-15(10-13)21(24)25/h3-10H,11H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | PCBMBVURCXTSKF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|