C27H29N5O4 — CID 41398381
N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N'-(3-nitrophenyl)oxamide (PubChem CID 41398381) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N'-(3-nitrophenyl)oxamide.
| Compound Name | N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N'-(3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 41398381 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N'-(3-nitrophenyl)oxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C27H29N5O4/c1-30(2)23-12-10-20(11-13-23)25(31-15-14-19-6-3-4-7-21(19)18-31)17-28-26(33)27(34)29-22-8-5-9-24(16-22)32(35)36/h3-13,16,25H,14-15,17-18H2,1-2H3,(H,28,33)(H,29,34)/t25-/m1/s1 |
| InChIKey | KDMNFWQZHLHDBH-RUZDIDTESA-N |
| XLogP | 3.52 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|