C24H32N4O3 — CID 7645538
N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N-(3-hydroxypropyl)oxamide (PubChem CID 7645538) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 7645538 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-N-(3-hydroxypropyl)oxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)C(=O)NCCCO)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-27(2)21-10-8-19(9-11-21)22(16-26-24(31)23(30)25-13-5-15-29)28-14-12-18-6-3-4-7-20(18)17-28/h3-4,6-11,22,29H,5,12-17H2,1-2H3,(H,25,30)(H,26,31)/t22-/m1/s1 |
| InChIKey | QKIRGRNCOSMOTD-JOCHJYFZSA-N |
| XLogP | 1.47 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|