C28H31ClN4O2 — CID 43996890
N-[(2-chlorophenyl)methyl]-N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]oxamide (PubChem CID 43996890) has the molecular formula C28H31ClN4O2 and a molecular weight of 491.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 43996890 |
| Molecular Formula | C28H31ClN4O2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]oxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C(=O)NCc2ccccc2Cl)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C28H31ClN4O2/c1-32(2)24-13-11-21(12-14-24)26(33-16-15-20-7-3-4-9-23(20)19-33)18-31-28(35)27(34)30-17-22-8-5-6-10-25(22)29/h3-14,26H,15-19H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | NSGFSKOMVRGURF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|