C20H25N3O4 — CID 7525755
N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(furan-2-yl)ethyl]-N-(3-hydroxypropyl)oxamide (PubChem CID 7525755) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(furan-2-yl)ethyl]-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(furan-2-yl)ethyl]-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 7525755 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N'-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(furan-2-yl)ethyl]-N-(3-hydroxypropyl)oxamide |
| SMILES | O=C(NCCCO)C(=O)NC[C@@H](c1ccco1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H25N3O4/c24-11-4-9-21-19(25)20(26)22-13-17(18-7-3-12-27-18)23-10-8-15-5-1-2-6-16(15)14-23/h1-3,5-7,12,17,24H,4,8-11,13-14H2,(H,21,25)(H,22,26)/t17-/m0/s1 |
| InChIKey | ATJVEZGGPLWMOY-KRWDZBQOSA-N |
| XLogP | 0.99 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|