About N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide
N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide (PubChem CID 108513255) has the molecular formula C10H10ClN3O4
and a molecular weight of 271.66 g/mol. Its IUPAC name is N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide |
| PubChem CID | 108513255 |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide |
| SMILES | O=C(NCCCl)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10ClN3O4/c11-4-5-12-9(15)10(16)13-7-2-1-3-8(6-7)14(17)18/h1-3,6H,4-5H2,(H,12,15)(H,13,16) |
| InChIKey | PHEDIHWHKXMHTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide?
The IUPAC name of N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide (CID 108513255) is N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide.
What is the SMILES notation for N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide?
The canonical SMILES for N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide is O=C(NCCCl)C(=O)Nc1cccc([N+](=O)[O-])c1.
What is the InChIKey of N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide?
The InChIKey is PHEDIHWHKXMHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O4/c11-4-5-12-9(15)10(16)13-7-2-1-3-8(6-7)14(17)18/h1-3,6H,4-5H2,(H,12,15)(H,13,16).
What are the key properties of N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide?
N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide has a molecular weight of 271.66 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-N'-(3-nitrophenyl)oxamide is sourced from PubChem (CID 108513255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).