C22H22ClN5O2 — CID 20608761
2-[2-(aminomethyl)-6-chloro-3-oxo-5-phenyl-4H-pyridin-4-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 20608761) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-chloro-3-oxo-5-phenyl-4H-pyridin-4-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[2-(aminomethyl)-6-chloro-3-oxo-5-phenyl-4H-pyridin-4-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 20608761 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[2-(aminomethyl)-6-chloro-3-oxo-5-phenyl-4H-pyridin-4-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CC2C(=O)C(CN)=NC(Cl)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22ClN5O2/c23-21-19(14-4-2-1-3-5-14)16(20(30)17(11-24)28-21)10-18(29)27-12-13-6-8-15(9-7-13)22(25)26/h1-9,16H,10-12,24H2,(H3,25,26)(H,27,29) |
| InChIKey | JYKRCYINEBKMSR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|