C21H23N5O6 — CID 157329231
3-[[3,6-diamino-5-(5-oxohexanoyl)pyrazine-2-carbonyl]amino]propanoyl benzoate (PubChem CID 157329231) has the molecular formula C21H23N5O6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[[3,6-diamino-5-(5-oxohexanoyl)pyrazine-2-carbonyl]amino]propanoyl benzoate.
| Compound Name | 3-[[3,6-diamino-5-(5-oxohexanoyl)pyrazine-2-carbonyl]amino]propanoyl benzoate |
|---|---|
| PubChem CID | 157329231 |
| Molecular Formula | C21H23N5O6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-[[3,6-diamino-5-(5-oxohexanoyl)pyrazine-2-carbonyl]amino]propanoyl benzoate |
| SMILES | CC(=O)CCCC(=O)c1nc(N)c(C(=O)NCCC(=O)OC(=O)c2ccccc2)nc1N |
| InChI | InChI=1S/C21H23N5O6/c1-12(27)6-5-9-14(28)16-18(22)26-17(19(23)25-16)20(30)24-11-10-15(29)32-21(31)13-7-3-2-4-8-13/h2-4,7-8H,5-6,9-11H2,1H3,(H2,22,26)(H2,23,25)(H,24,30) |
| InChIKey | YFBORZYWSRPHPC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 184.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|