C11H14N2O5S — CID 107775072
(2R)-2-acetamido-3-(pyridin-4-ylmethylsulfonyl)propanoic acid (PubChem CID 107775072) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(pyridin-4-ylmethylsulfonyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(pyridin-4-ylmethylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 107775072 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (2R)-2-acetamido-3-(pyridin-4-ylmethylsulfonyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)(=O)Cc1ccncc1)C(=O)O |
| InChI | InChI=1S/C11H14N2O5S/c1-8(14)13-10(11(15)16)7-19(17,18)6-9-2-4-12-5-3-9/h2-5,10H,6-7H2,1H3,(H,13,14)(H,15,16)/t10-/m0/s1 |
| InChIKey | VUBRVRFDYMNNOH-JTQLQIEISA-N |
| XLogP | -0.41 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |