C17H18N4O3 — CID 24838768
N-[1-oxo-3-phenyl-1-[2-(pyridine-4-carbonyl)hydrazinyl]propan-2-yl]acetamide (PubChem CID 24838768) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[1-oxo-3-phenyl-1-[2-(pyridine-4-carbonyl)hydrazinyl]propan-2-yl]acetamide.
| Compound Name | N-[1-oxo-3-phenyl-1-[2-(pyridine-4-carbonyl)hydrazinyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 24838768 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[1-oxo-3-phenyl-1-[2-(pyridine-4-carbonyl)hydrazinyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H18N4O3/c1-12(22)19-15(11-13-5-3-2-4-6-13)17(24)21-20-16(23)14-7-9-18-10-8-14/h2-10,15H,11H2,1H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | HENBIQRCTCZLEU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|