C18H21N3O6S — CID 18368954
2-[(2-anilinoacetyl)amino]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide (PubChem CID 18368954) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[(2-anilinoacetyl)amino]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide.
| Compound Name | 2-[(2-anilinoacetyl)amino]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 18368954 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[(2-anilinoacetyl)amino]-N-hydroxy-3-(4-methoxyphenyl)sulfonylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)CC(NC(=O)CNc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C18H21N3O6S/c1-27-14-7-9-15(10-8-14)28(25,26)12-16(18(23)21-24)20-17(22)11-19-13-5-3-2-4-6-13/h2-10,16,19,24H,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OADFYLLPIAVAQL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|