C21H24ClNO6S — CID 22893204
methyl 2-[(2-chloroacetyl)amino]-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanoate (PubChem CID 22893204) has the molecular formula C21H24ClNO6S and a molecular weight of 453.94 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)amino]-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanoate.
| Compound Name | methyl 2-[(2-chloroacetyl)amino]-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 22893204 |
| Molecular Formula | C21H24ClNO6S |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)amino]-3,3-dimethyl-4-(4-phenoxyphenyl)sulfonylbutanoate |
| SMILES | COC(=O)C(NC(=O)CCl)C(C)(C)CS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24ClNO6S/c1-21(2,19(20(25)28-3)23-18(24)13-22)14-30(26,27)17-11-9-16(10-12-17)29-15-7-5-4-6-8-15/h4-12,19H,13-14H2,1-3H3,(H,23,24) |
| InChIKey | VANHXGLGXOADOM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|