C24H31N3O7S — CID 22893212
N-hydroxy-3,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]-4-(4-phenoxyphenyl)sulfonylbutanamide (PubChem CID 22893212) has the molecular formula C24H31N3O7S and a molecular weight of 505.59 g/mol. Its IUPAC name is N-hydroxy-3,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]-4-(4-phenoxyphenyl)sulfonylbutanamide.
| Compound Name | N-hydroxy-3,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]-4-(4-phenoxyphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 22893212 |
| Molecular Formula | C24H31N3O7S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-hydroxy-3,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]-4-(4-phenoxyphenyl)sulfonylbutanamide |
| SMILES | CC(C)(CS(=O)(=O)c1ccc(Oc2ccccc2)cc1)C(NC(=O)CN1CCOCC1)C(=O)NO |
| InChI | InChI=1S/C24H31N3O7S/c1-24(2,22(23(29)26-30)25-21(28)16-27-12-14-33-15-13-27)17-35(31,32)20-10-8-19(9-11-20)34-18-6-4-3-5-7-18/h3-11,22,30H,12-17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | KCNFHQYHEXSYEY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|