C26H29N2O6P — CID 3302290
N-[diphenoxyphosphoryl-(4-methoxyphenyl)methyl]-2-morpholin-4-ylacetamide (PubChem CID 3302290) has the molecular formula C26H29N2O6P and a molecular weight of 496.50 g/mol. Its IUPAC name is N-[diphenoxyphosphoryl-(4-methoxyphenyl)methyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[diphenoxyphosphoryl-(4-methoxyphenyl)methyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 3302290 |
| Molecular Formula | C26H29N2O6P |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[diphenoxyphosphoryl-(4-methoxyphenyl)methyl]-2-morpholin-4-ylacetamide |
| SMILES | COc1ccc(C(NC(=O)CN2CCOCC2)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N2O6P/c1-31-22-14-12-21(13-15-22)26(27-25(29)20-28-16-18-32-19-17-28)35(30,33-23-8-4-2-5-9-23)34-24-10-6-3-7-11-24/h2-15,26H,16-20H2,1H3,(H,27,29) |
| InChIKey | PCIYATSTYKJPQX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|