C25H25Cl2N2O5P — CID 5010848
N-[(2,4-dichlorophenyl)-diphenoxyphosphorylmethyl]-2-morpholin-4-ylacetamide (PubChem CID 5010848) has the molecular formula C25H25Cl2N2O5P and a molecular weight of 535.36 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)-diphenoxyphosphorylmethyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(2,4-dichlorophenyl)-diphenoxyphosphorylmethyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 5010848 |
| Molecular Formula | C25H25Cl2N2O5P |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | N-[(2,4-dichlorophenyl)-diphenoxyphosphorylmethyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)NC(c1ccc(Cl)cc1Cl)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H25Cl2N2O5P/c26-19-11-12-22(23(27)17-19)25(28-24(30)18-29-13-15-32-16-14-29)35(31,33-20-7-3-1-4-8-20)34-21-9-5-2-6-10-21/h1-12,17,25H,13-16,18H2,(H,28,30) |
| InChIKey | AIFTVRAEKOGTQQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|