C18H21NO6S — CID 22732218
3-[4-(3,4-dimethylphenoxy)phenyl]sulfonyl-N,2-dihydroxy-2-methylpropanamide (PubChem CID 22732218) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is 3-[4-(3,4-dimethylphenoxy)phenyl]sulfonyl-N,2-dihydroxy-2-methylpropanamide.
| Compound Name | 3-[4-(3,4-dimethylphenoxy)phenyl]sulfonyl-N,2-dihydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 22732218 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-[4-(3,4-dimethylphenoxy)phenyl]sulfonyl-N,2-dihydroxy-2-methylpropanamide |
| SMILES | Cc1ccc(Oc2ccc(S(=O)(=O)CC(C)(O)C(=O)NO)cc2)cc1C |
| InChI | InChI=1S/C18H21NO6S/c1-12-4-5-15(10-13(12)2)25-14-6-8-16(9-7-14)26(23,24)11-18(3,21)17(20)19-22/h4-10,21-22H,11H2,1-3H3,(H,19,20) |
| InChIKey | HGSYAZIRJBKOMU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|