C20H26N2O5S — CID 142160384
(2R)-1-ethyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylmethyl]-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 142160384) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is (2R)-1-ethyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylmethyl]-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-ethyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylmethyl]-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142160384 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (2R)-1-ethyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]sulfonylmethyl]-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | C=C/C=C(\C=C)Oc1ccc(S(=O)(=O)C[C@]2(C(=O)NO)CCCN2CC)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-4-8-16(5-2)27-17-9-11-18(12-10-17)28(25,26)15-20(19(23)21-24)13-7-14-22(20)6-3/h4-5,8-12,24H,1-2,6-7,13-15H2,3H3,(H,21,23)/b16-8+/t20-/m0/s1 |
| InChIKey | MKCYPCYKKAGBBI-GNYRPXIHSA-N |
| XLogP | 2.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|