C16H25N3O7S2 — CID 11797154
(2R,4S)-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-[methylsulfonyl(propyl)amino]pyrrolidine-2-carboxamide (PubChem CID 11797154) has the molecular formula C16H25N3O7S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2R,4S)-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-[methylsulfonyl(propyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-[methylsulfonyl(propyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11797154 |
| Molecular Formula | C16H25N3O7S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2R,4S)-N-hydroxy-1-(4-methoxyphenyl)sulfonyl-4-[methylsulfonyl(propyl)amino]pyrrolidine-2-carboxamide |
| SMILES | CCCN([C@H]1C[C@H](C(=O)NO)N(S(=O)(=O)c2ccc(OC)cc2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C16H25N3O7S2/c1-4-9-18(27(3,22)23)12-10-15(16(20)17-21)19(11-12)28(24,25)14-7-5-13(26-2)6-8-14/h5-8,12,15,21H,4,9-11H2,1-3H3,(H,17,20)/t12-,15+/m0/s1 |
| InChIKey | CPBPQYOAJUZJNL-SWLSCSKDSA-N |
| XLogP | 0.00 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|