C20H26O — CID 143570219
1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene (PubChem CID 143570219) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene.
| Compound Name | 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene |
|---|---|
| PubChem CID | 143570219 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene |
| SMILES | C=C/C(=C\C)Oc1ccc(C(C)(C)C(/C=C\C)=C/C)cc1 |
| InChI | InChI=1S/C20H26O/c1-7-11-16(8-2)20(5,6)17-12-14-19(15-13-17)21-18(9-3)10-4/h7-15H,3H2,1-2,4-6H3/b11-7-,16-8+,18-10+ |
| InChIKey | UBCDGDWYGYHZNT-UOPNFOKNSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|