About 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene
1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene (PubChem CID 143570219) has the molecular formula C20H26O
and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene.
Molecular Properties
| Compound Name | 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene |
| PubChem CID | 143570219 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene |
| SMILES | C=C/C(=C\C)Oc1ccc(C(C)(C)C(/C=C\C)=C/C)cc1 |
| InChI | InChI=1S/C20H26O/c1-7-11-16(8-2)20(5,6)17-12-14-19(15-13-17)21-18(9-3)10-4/h7-15H,3H2,1-2,4-6H3/b11-7-,16-8+,18-10+ |
| InChIKey | UBCDGDWYGYHZNT-UOPNFOKNSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene?
The IUPAC name of 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene (CID 143570219) is 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene.
What is the SMILES notation for 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene?
The canonical SMILES for 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene is C=C/C(=C\C)Oc1ccc(C(C)(C)C(/C=C\C)=C/C)cc1.
What is the InChIKey of 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene?
The InChIKey is UBCDGDWYGYHZNT-UOPNFOKNSA-N. The full InChI is InChI=1S/C20H26O/c1-7-11-16(8-2)20(5,6)17-12-14-19(15-13-17)21-18(9-3)10-4/h7-15H,3H2,1-2,4-6H3/b11-7-,16-8+,18-10+.
What are the key properties of 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene?
1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene has a molecular weight of 282.43 g/mol, XLogP of 5.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,3E)-3-ethylidene-2-methylhex-4-en-2-yl]-4-[(3E)-penta-1,3-dien-3-yl]oxybenzene is sourced from PubChem (CID 143570219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).