C32H50O3 — CID 142037298
bis(1-(2,2-dimethylcyclopropyl)ethanone);1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxybenzene;ethane (PubChem CID 142037298) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is bis(1-(2,2-dimethylcyclopropyl)ethanone);1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxybenzene;ethane.
| Compound Name | bis(1-(2,2-dimethylcyclopropyl)ethanone);1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxybenzene;ethane |
|---|---|
| PubChem CID | 142037298 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | bis(1-(2,2-dimethylcyclopropyl)ethanone);1,2-dimethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxybenzene;ethane |
| SMILES | C=C/C(C)=C\C=C(/C)Oc1ccc(C)c(C)c1.CC.CC(=O)C1CC1(C)C.CC(=O)C1CC1(C)C |
| InChI | InChI=1S/C16H20O.2C7H12O.C2H6/c1-6-12(2)7-9-15(5)17-16-10-8-13(3)14(4)11-16;2*1-5(8)6-4-7(6,2)3;1-2/h6-11H,1H2,2-5H3;2*6H,4H2,1-3H3;1-2H3/b12-7-,15-9+;;; |
| InChIKey | WOHCQGCDWMXHPB-NJJOPLBLSA-N |
| XLogP | 8.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|