C16H22N2O2 — CID 142867351
N-methylacetamide;4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypyridine (PubChem CID 142867351) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-methylacetamide;4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypyridine.
| Compound Name | N-methylacetamide;4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypyridine |
|---|---|
| PubChem CID | 142867351 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-methylacetamide;4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypyridine |
| SMILES | C=C/C(C)=C\C=C(/C)Oc1ccncc1.CNC(C)=O |
| InChI | InChI=1S/C13H15NO.C3H7NO/c1-4-11(2)5-6-12(3)15-13-7-9-14-10-8-13;1-3(5)4-2/h4-10H,1H2,2-3H3;1-2H3,(H,4,5)/b11-5-,12-6+; |
| InChIKey | DCCIPCWJOOJSKK-KFKREPKWSA-N |
| XLogP | 3.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|