About (4-ethenylphenyl) acetate;oxophosphane
(4-ethenylphenyl) acetate;oxophosphane (PubChem CID 175041738) has the molecular formula C10H11O3P
and a molecular weight of 210.17 g/mol. Its IUPAC name is (4-ethenylphenyl) acetate;oxophosphane.
Molecular Properties
| Compound Name | (4-ethenylphenyl) acetate;oxophosphane |
| PubChem CID | 175041738 |
| Molecular Formula | C10H11O3P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (4-ethenylphenyl) acetate;oxophosphane |
| SMILES | C=Cc1ccc(OC(C)=O)cc1.O=P |
| InChI | InChI=1S/C10H10O2.HOP/c1-3-9-4-6-10(7-5-9)12-8(2)11;1-2/h3-7H,1H2,2H3;2H |
| InChIKey | POPWZTRRTOZQBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl) acetate;oxophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl) acetate;oxophosphane?
The IUPAC name of (4-ethenylphenyl) acetate;oxophosphane (CID 175041738) is (4-ethenylphenyl) acetate;oxophosphane.
What is the SMILES notation for (4-ethenylphenyl) acetate;oxophosphane?
The canonical SMILES for (4-ethenylphenyl) acetate;oxophosphane is C=Cc1ccc(OC(C)=O)cc1.O=P.
What is the InChIKey of (4-ethenylphenyl) acetate;oxophosphane?
The InChIKey is POPWZTRRTOZQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.HOP/c1-3-9-4-6-10(7-5-9)12-8(2)11;1-2/h3-7H,1H2,2H3;2H.
What are the key properties of (4-ethenylphenyl) acetate;oxophosphane?
(4-ethenylphenyl) acetate;oxophosphane has a molecular weight of 210.17 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl) acetate;oxophosphane is sourced from PubChem (CID 175041738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).