About N-methylacetamide;4-(3-methylphenoxy)pyridine
N-methylacetamide;4-(3-methylphenoxy)pyridine (PubChem CID 142886690) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is N-methylacetamide;4-(3-methylphenoxy)pyridine.
Molecular Properties
| Compound Name | N-methylacetamide;4-(3-methylphenoxy)pyridine |
| PubChem CID | 142886690 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-methylacetamide;4-(3-methylphenoxy)pyridine |
| SMILES | CNC(C)=O.Cc1cccc(Oc2ccncc2)c1 |
| InChI | InChI=1S/C12H11NO.C3H7NO/c1-10-3-2-4-12(9-10)14-11-5-7-13-8-6-11;1-3(5)4-2/h2-9H,1H3;1-2H3,(H,4,5) |
| InChIKey | SZKCFSFXWZKVRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylacetamide;4-(3-methylphenoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;4-(3-methylphenoxy)pyridine?
The IUPAC name of N-methylacetamide;4-(3-methylphenoxy)pyridine (CID 142886690) is N-methylacetamide;4-(3-methylphenoxy)pyridine.
What is the SMILES notation for N-methylacetamide;4-(3-methylphenoxy)pyridine?
The canonical SMILES for N-methylacetamide;4-(3-methylphenoxy)pyridine is CNC(C)=O.Cc1cccc(Oc2ccncc2)c1.
What is the InChIKey of N-methylacetamide;4-(3-methylphenoxy)pyridine?
The InChIKey is SZKCFSFXWZKVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C3H7NO/c1-10-3-2-4-12(9-10)14-11-5-7-13-8-6-11;1-3(5)4-2/h2-9H,1H3;1-2H3,(H,4,5).
What are the key properties of N-methylacetamide;4-(3-methylphenoxy)pyridine?
N-methylacetamide;4-(3-methylphenoxy)pyridine has a molecular weight of 258.32 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;4-(3-methylphenoxy)pyridine is sourced from PubChem (CID 142886690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).