C16H21Cl2N3O2 — CID 119429876
N-[3-(methylamino)propyl]-3-pyridin-4-yloxybenzamide;dihydrochloride (PubChem CID 119429876) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-3-pyridin-4-yloxybenzamide;dihydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-3-pyridin-4-yloxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 119429876 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[3-(methylamino)propyl]-3-pyridin-4-yloxybenzamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1cccc(Oc2ccncc2)c1.Cl.Cl |
| InChI | InChI=1S/C16H19N3O2.2ClH/c1-17-8-3-9-19-16(20)13-4-2-5-15(12-13)21-14-6-10-18-11-7-14;;/h2,4-7,10-12,17H,3,8-9H2,1H3,(H,19,20);2*1H |
| InChIKey | IEGSLUARVXBLEH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|