C27H30N2O4 — CID 143062081
N-[4-oxo-4-(3-pyridin-4-yloxyphenyl)butyl]-4-pentoxybenzamide (PubChem CID 143062081) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[4-oxo-4-(3-pyridin-4-yloxyphenyl)butyl]-4-pentoxybenzamide.
| Compound Name | N-[4-oxo-4-(3-pyridin-4-yloxyphenyl)butyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 143062081 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[4-oxo-4-(3-pyridin-4-yloxyphenyl)butyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NCCCC(=O)c2cccc(Oc3ccncc3)c2)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-2-3-4-19-32-23-12-10-21(11-13-23)27(31)29-16-6-9-26(30)22-7-5-8-25(20-22)33-24-14-17-28-18-15-24/h5,7-8,10-15,17-18,20H,2-4,6,9,16,19H2,1H3,(H,29,31) |
| InChIKey | LNDIJIURHLWXAC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|