About methanesulfonic acid;3-(3-methylphenoxy)pyridine
methanesulfonic acid;3-(3-methylphenoxy)pyridine (PubChem CID 117068642) has the molecular formula C13H15NO4S
and a molecular weight of 281.33 g/mol. Its IUPAC name is methanesulfonic acid;3-(3-methylphenoxy)pyridine.
Molecular Properties
| Compound Name | methanesulfonic acid;3-(3-methylphenoxy)pyridine |
| PubChem CID | 117068642 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methanesulfonic acid;3-(3-methylphenoxy)pyridine |
| SMILES | CS(=O)(=O)O.Cc1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C12H11NO.CH4O3S/c1-10-4-2-5-11(8-10)14-12-6-3-7-13-9-12;1-5(2,3)4/h2-9H,1H3;1H3,(H,2,3,4) |
| InChIKey | FMOWQCQCPXEBNL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;3-(3-methylphenoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;3-(3-methylphenoxy)pyridine?
The IUPAC name of methanesulfonic acid;3-(3-methylphenoxy)pyridine (CID 117068642) is methanesulfonic acid;3-(3-methylphenoxy)pyridine.
What is the SMILES notation for methanesulfonic acid;3-(3-methylphenoxy)pyridine?
The canonical SMILES for methanesulfonic acid;3-(3-methylphenoxy)pyridine is CS(=O)(=O)O.Cc1cccc(Oc2cccnc2)c1.
What is the InChIKey of methanesulfonic acid;3-(3-methylphenoxy)pyridine?
The InChIKey is FMOWQCQCPXEBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.CH4O3S/c1-10-4-2-5-11(8-10)14-12-6-3-7-13-9-12;1-5(2,3)4/h2-9H,1H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;3-(3-methylphenoxy)pyridine?
methanesulfonic acid;3-(3-methylphenoxy)pyridine has a molecular weight of 281.33 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;3-(3-methylphenoxy)pyridine is sourced from PubChem (CID 117068642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).