C20H20N2O3S — CID 142303722
formic acid;2-[(3-methylanilino)methyl]-4-pyridin-3-yloxybenzenethiol (PubChem CID 142303722) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is formic acid;2-[(3-methylanilino)methyl]-4-pyridin-3-yloxybenzenethiol.
| Compound Name | formic acid;2-[(3-methylanilino)methyl]-4-pyridin-3-yloxybenzenethiol |
|---|---|
| PubChem CID | 142303722 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | formic acid;2-[(3-methylanilino)methyl]-4-pyridin-3-yloxybenzenethiol |
| SMILES | Cc1cccc(NCc2cc(Oc3cccnc3)ccc2S)c1.O=CO |
| InChI | InChI=1S/C19H18N2OS.CH2O2/c1-14-4-2-5-16(10-14)21-12-15-11-17(7-8-19(15)23)22-18-6-3-9-20-13-18;2-1-3/h2-11,13,21,23H,12H2,1H3;1H,(H,2,3) |
| InChIKey | AWDBJBPMPPTTGD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|