C10H10Cl2O — CID 14317674
4-[(E)-1,2-dichloroethenoxy]-1,2-dimethylbenzene (PubChem CID 14317674) has the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. Its IUPAC name is 4-[(E)-1,2-dichloroethenoxy]-1,2-dimethylbenzene.
| Compound Name | 4-[(E)-1,2-dichloroethenoxy]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 14317674 |
| Molecular Formula | C10H10Cl2O |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 4-[(E)-1,2-dichloroethenoxy]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(O/C(Cl)=C\Cl)cc1C |
| InChI | InChI=1S/C10H10Cl2O/c1-7-3-4-9(5-8(7)2)13-10(12)6-11/h3-6H,1-2H3/b10-6- |
| InChIKey | NJTMTSCZQJLUIO-POHAHGRESA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|