C10H9F3O — CID 18956451
1,2-dimethyl-4-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 18956451) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is 1,2-dimethyl-4-(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 1,2-dimethyl-4-(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 18956451 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1,2-dimethyl-4-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | Cc1ccc(OC(F)=C(F)F)cc1C |
| InChI | InChI=1S/C10H9F3O/c1-6-3-4-8(5-7(6)2)14-10(13)9(11)12/h3-5H,1-2H3 |
| InChIKey | LNKWTPWYZNXIMF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|