C12H3F9O3 — CID 122715531
1,3,5-tris(1,2,2-trifluoroethenoxy)benzene (PubChem CID 122715531) has the molecular formula C12H3F9O3 and a molecular weight of 366.14 g/mol. Its IUPAC name is 1,3,5-tris(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 1,3,5-tris(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 122715531 |
| Molecular Formula | C12H3F9O3 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 1,3,5-tris(1,2,2-trifluoroethenoxy)benzene |
| SMILES | FC(F)=C(F)Oc1cc(OC(F)=C(F)F)cc(OC(F)=C(F)F)c1 |
| InChI | InChI=1S/C12H3F9O3/c13-7(14)10(19)22-4-1-5(23-11(20)8(15)16)3-6(2-4)24-12(21)9(17)18/h1-3H |
| InChIKey | IKJGZKGXZGFVFZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|