C26H18F6O5 — CID 163885683
1-[3,5-bis[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethanone (PubChem CID 163885683) has the molecular formula C26H18F6O5 and a molecular weight of 524.41 g/mol. Its IUPAC name is 1-[3,5-bis[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethanone.
| Compound Name | 1-[3,5-bis[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 163885683 |
| Molecular Formula | C26H18F6O5 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 1-[3,5-bis[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cc(OCc2ccc(OC(F)=C(F)F)cc2)cc(OCc2ccc(OC(F)=C(F)F)cc2)c1 |
| InChI | InChI=1S/C26H18F6O5/c1-15(33)18-10-21(34-13-16-2-6-19(7-3-16)36-25(31)23(27)28)12-22(11-18)35-14-17-4-8-20(9-5-17)37-26(32)24(29)30/h2-12H,13-14H2,1H3 |
| InChIKey | PXCSOZNCNIFCAM-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|