C26H15F9O3 — CID 54280605
1-[1,2-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]-4-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 54280605) has the molecular formula C26H15F9O3 and a molecular weight of 546.39 g/mol. Its IUPAC name is 1-[1,2-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]-4-(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 1-[1,2-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]-4-(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 54280605 |
| Molecular Formula | C26H15F9O3 |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 1-[1,2-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]-4-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | FC(F)=C(F)Oc1ccc(CC(c2ccc(OC(F)=C(F)F)cc2)c2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H15F9O3/c27-21(28)24(33)36-17-7-1-14(2-8-17)13-20(15-3-9-18(10-4-15)37-25(34)22(29)30)16-5-11-19(12-6-16)38-26(35)23(31)32/h1-12,20H,13H2 |
| InChIKey | RQNCXPWHFMKGRS-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|