C27H24N2O3 — CID 118554212
[4-[2,2-bis(4-aminophenyl)ethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 118554212) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is [4-[2,2-bis(4-aminophenyl)ethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-[2,2-bis(4-aminophenyl)ethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 118554212 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [4-[2,2-bis(4-aminophenyl)ethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | Nc1ccc(C(Cc2ccc(OC(=O)/C=C/c3ccco3)cc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O3/c28-22-9-5-20(6-10-22)26(21-7-11-23(29)12-8-21)18-19-3-13-25(14-4-19)32-27(30)16-15-24-2-1-17-31-24/h1-17,26H,18,28-29H2/b16-15+ |
| InChIKey | ZKGNXPGHCXAZJO-FOCLMDBBSA-N |
| XLogP | 5.44 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|