C47H33F6N3O — CID 89074273
1-N,4-N-diphenyl-4-N-[4-(N-[4-(1,2,2-trifluoroethenoxy)phenyl]anilino)phenyl]-1-N-[4-(2,3,3-trifluoroprop-2-enyl)phenyl]benzene-1,4-diamine (PubChem CID 89074273) has the molecular formula C47H33F6N3O and a molecular weight of 769.79 g/mol. Its IUPAC name is 1-N,4-N-diphenyl-4-N-[4-(N-[4-(1,2,2-trifluoroethenoxy)phenyl]anilino)phenyl]-1-N-[4-(2,3,3-trifluoroprop-2-enyl)phenyl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-diphenyl-4-N-[4-(N-[4-(1,2,2-trifluoroethenoxy)phenyl]anilino)phenyl]-1-N-[4-(2,3,3-trifluoroprop-2-enyl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89074273 |
| Molecular Formula | C47H33F6N3O |
| Molecular Weight | 769.79 g/mol |
| Exact Mass | 769.25 |
| IUPAC Name | 1-N,4-N-diphenyl-4-N-[4-(N-[4-(1,2,2-trifluoroethenoxy)phenyl]anilino)phenyl]-1-N-[4-(2,3,3-trifluoroprop-2-enyl)phenyl]benzene-1,4-diamine |
| SMILES | FC(F)=C(F)Cc1ccc(N(c2ccccc2)c2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccc(OC(F)=C(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H33F6N3O/c48-44(45(49)50)32-33-16-18-37(19-17-33)54(34-10-4-1-5-11-34)38-20-22-39(23-21-38)55(35-12-6-2-7-13-35)40-24-26-41(27-25-40)56(36-14-8-3-9-15-36)42-28-30-43(31-29-42)57-47(53)46(51)52/h1-31H,32H2 |
| InChIKey | UECCIWUIEMSXFB-UHFFFAOYSA-N |
| XLogP | 15.13 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.79 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|