C9H4F3O3- — CID 7171801
4-(1,2,2-trifluoroethenoxy)benzoate (PubChem CID 7171801) has the molecular formula C9H4F3O3- and a molecular weight of 217.12 g/mol. Its IUPAC name is 4-(1,2,2-trifluoroethenoxy)benzoate.
| Compound Name | 4-(1,2,2-trifluoroethenoxy)benzoate |
|---|---|
| PubChem CID | 7171801 |
| Molecular Formula | C9H4F3O3- |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 4-(1,2,2-trifluoroethenoxy)benzoate |
| SMILES | O=C([O-])c1ccc(OC(F)=C(F)F)cc1 |
| InChI | InChI=1S/C9H5F3O3/c10-7(11)8(12)15-6-3-1-5(2-4-6)9(13)14/h1-4H,(H,13,14)/p-1 |
| InChIKey | RSARXEGXWPNARA-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|