C25H13F9O3 — CID 57246237
1-[bis[4-(1,2,2-trifluoroethenoxy)phenyl]methyl]-4-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 57246237) has the molecular formula C25H13F9O3 and a molecular weight of 532.36 g/mol. Its IUPAC name is 1-[bis[4-(1,2,2-trifluoroethenoxy)phenyl]methyl]-4-(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 1-[bis[4-(1,2,2-trifluoroethenoxy)phenyl]methyl]-4-(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 57246237 |
| Molecular Formula | C25H13F9O3 |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 1-[bis[4-(1,2,2-trifluoroethenoxy)phenyl]methyl]-4-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | FC(F)=C(F)Oc1ccc(C(c2ccc(OC(F)=C(F)F)cc2)c2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H13F9O3/c26-20(27)23(32)35-16-7-1-13(2-8-16)19(14-3-9-17(10-4-14)36-24(33)21(28)29)15-5-11-18(12-6-15)37-25(34)22(30)31/h1-12,19H |
| InChIKey | SSWXUJXISICMOA-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|