C18H8F6O6-2 — CID 7158824
4-[(1S,2S)-2-(4-carboxylatophenoxy)-1,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoate (PubChem CID 7158824) has the molecular formula C18H8F6O6-2 and a molecular weight of 434.24 g/mol. Its IUPAC name is 4-[(1S,2S)-2-(4-carboxylatophenoxy)-1,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoate.
| Compound Name | 4-[(1S,2S)-2-(4-carboxylatophenoxy)-1,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoate |
|---|---|
| PubChem CID | 7158824 |
| Molecular Formula | C18H8F6O6-2 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 4-[(1S,2S)-2-(4-carboxylatophenoxy)-1,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoate |
| SMILES | O=C([O-])c1ccc(O[C@@]2(F)C(F)(F)C(F)(F)[C@]2(F)Oc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H10F6O6/c19-15(20)16(21,22)18(24,30-12-7-3-10(4-8-12)14(27)28)17(15,23)29-11-5-1-9(2-6-11)13(25)26/h1-8H,(H,25,26)(H,27,28)/p-2/t17-,18-/m0/s1 |
| InChIKey | AUTFDDDGQZIXCF-ROUUACIJSA-L |
| XLogP | 1.49 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|