C18H8Cl2F6O4 — CID 88512011
4-[1-(4-carbonochloridoylphenoxy)-2,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoyl chloride (PubChem CID 88512011) has the molecular formula C18H8Cl2F6O4 and a molecular weight of 473.15 g/mol. Its IUPAC name is 4-[1-(4-carbonochloridoylphenoxy)-2,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoyl chloride.
| Compound Name | 4-[1-(4-carbonochloridoylphenoxy)-2,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoyl chloride |
|---|---|
| PubChem CID | 88512011 |
| Molecular Formula | C18H8Cl2F6O4 |
| Molecular Weight | 473.15 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 4-[1-(4-carbonochloridoylphenoxy)-2,2,3,3,4,4-hexafluorocyclobutyl]oxybenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(OC2(Oc3ccc(C(=O)Cl)cc3)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C18H8Cl2F6O4/c19-13(27)9-1-5-11(6-2-9)29-18(16(23,24)15(21,22)17(18,25)26)30-12-7-3-10(4-8-12)14(20)28/h1-8H |
| InChIKey | ZGNCJXMNKDWNPP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.15 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|