C28H18F6O8S2 — CID 155313256
4-[4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-hydroxyphenyl)sulfonylphenoxy]cyclobutyl]oxyphenyl]sulfonylphenol (PubChem CID 155313256) has the molecular formula C28H18F6O8S2 and a molecular weight of 660.57 g/mol. Its IUPAC name is 4-[4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-hydroxyphenyl)sulfonylphenoxy]cyclobutyl]oxyphenyl]sulfonylphenol.
| Compound Name | 4-[4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-hydroxyphenyl)sulfonylphenoxy]cyclobutyl]oxyphenyl]sulfonylphenol |
|---|---|
| PubChem CID | 155313256 |
| Molecular Formula | C28H18F6O8S2 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 660.03 |
| IUPAC Name | 4-[4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-hydroxyphenyl)sulfonylphenoxy]cyclobutyl]oxyphenyl]sulfonylphenol |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(OC2(F)C(F)(F)C(F)(F)C2(F)Oc2ccc(S(=O)(=O)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H18F6O8S2/c29-25(30)26(31,32)28(34,42-20-7-15-24(16-8-20)44(39,40)22-11-3-18(36)4-12-22)27(25,33)41-19-5-13-23(14-6-19)43(37,38)21-9-1-17(35)2-10-21/h1-16,35-36H |
| InChIKey | OIZOVDWUDONKOW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|