C13H17NS — CID 143876226
methyl N-[1-(3,4-dimethylphenyl)ethenyl]ethanimidothioate (PubChem CID 143876226) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is methyl N-[1-(3,4-dimethylphenyl)ethenyl]ethanimidothioate.
| Compound Name | methyl N-[1-(3,4-dimethylphenyl)ethenyl]ethanimidothioate |
|---|---|
| PubChem CID | 143876226 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | methyl N-[1-(3,4-dimethylphenyl)ethenyl]ethanimidothioate |
| SMILES | C=C(/N=C(\C)SC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H17NS/c1-9-6-7-13(8-10(9)2)11(3)14-12(4)15-5/h6-8H,3H2,1-2,4-5H3/b14-12+ |
| InChIKey | VQFBNMVFURNHBN-WYMLVPIESA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|