C21H30FNS — CID 167030762
fluoro N-[1-[4-(4-ethyloct-7-enyl)-3-methylphenyl]ethenyl]ethanimidothioate (PubChem CID 167030762) has the molecular formula C21H30FNS and a molecular weight of 347.54 g/mol. Its IUPAC name is fluoro N-[1-[4-(4-ethyloct-7-enyl)-3-methylphenyl]ethenyl]ethanimidothioate.
| Compound Name | fluoro N-[1-[4-(4-ethyloct-7-enyl)-3-methylphenyl]ethenyl]ethanimidothioate |
|---|---|
| PubChem CID | 167030762 |
| Molecular Formula | C21H30FNS |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | fluoro N-[1-[4-(4-ethyloct-7-enyl)-3-methylphenyl]ethenyl]ethanimidothioate |
| SMILES | C=CCCC(CC)CCCc1ccc(C(=C)/N=C(\C)SF)cc1C |
| InChI | InChI=1S/C21H30FNS/c1-6-8-10-19(7-2)11-9-12-20-13-14-21(15-16(20)3)17(4)23-18(5)24-22/h6,13-15,19H,1,4,7-12H2,2-3,5H3/b23-18+ |
| InChIKey | JZXMFJVFAPBDAR-PTGBLXJZSA-N |
| XLogP | 7.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|