C25H42 — CID 144921348
4-ethyloctane;1-methyl-4-[(3E)-penta-1,3-dien-3-yl]-2-propylbenzene (PubChem CID 144921348) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is 4-ethyloctane;1-methyl-4-[(3E)-penta-1,3-dien-3-yl]-2-propylbenzene.
| Compound Name | 4-ethyloctane;1-methyl-4-[(3E)-penta-1,3-dien-3-yl]-2-propylbenzene |
|---|---|
| PubChem CID | 144921348 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 4-ethyloctane;1-methyl-4-[(3E)-penta-1,3-dien-3-yl]-2-propylbenzene |
| SMILES | C=C/C(=C\C)c1ccc(C)c(CCC)c1.CCCCC(CC)CCC |
| InChI | InChI=1S/C15H20.C10H22/c1-5-8-14-11-15(10-9-12(14)4)13(6-2)7-3;1-4-7-9-10(6-3)8-5-2/h6-7,9-11H,2,5,8H2,1,3-4H3;10H,4-9H2,1-3H3/b13-7+; |
| InChIKey | MLPVASPLTFQJTB-FTPOTTDRSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|