C20H28F2 — CID 144757016
1-(6,6-difluoro-3-propylhexan-2-yl)-3-[(3E)-penta-1,3-dien-3-yl]benzene (PubChem CID 144757016) has the molecular formula C20H28F2 and a molecular weight of 306.44 g/mol. Its IUPAC name is 1-(6,6-difluoro-3-propylhexan-2-yl)-3-[(3E)-penta-1,3-dien-3-yl]benzene.
| Compound Name | 1-(6,6-difluoro-3-propylhexan-2-yl)-3-[(3E)-penta-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 144757016 |
| Molecular Formula | C20H28F2 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-(6,6-difluoro-3-propylhexan-2-yl)-3-[(3E)-penta-1,3-dien-3-yl]benzene |
| SMILES | C=C/C(=C\C)c1cccc(C(C)C(CCC)CCC(F)F)c1 |
| InChI | InChI=1S/C20H28F2/c1-5-9-17(12-13-20(21)22)15(4)18-10-8-11-19(14-18)16(6-2)7-3/h6-8,10-11,14-15,17,20H,2,5,9,12-13H2,1,3-4H3/b16-7+ |
| InChIKey | DCMHQVJIPKMMAW-FRKPEAEDSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|